C22H21F6NO4 — CID 52920926
5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,8-dimethoxyphenanthridin-6-one (PubChem CID 52920926) has the molecular formula C22H21F6NO4 and a molecular weight of 477.40 g/mol. Its IUPAC name is 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,8-dimethoxyphenanthridin-6-one.
| Compound Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,8-dimethoxyphenanthridin-6-one |
|---|---|
| PubChem CID | 52920926 |
| Molecular Formula | C22H21F6NO4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,8-dimethoxyphenanthridin-6-one |
| SMILES | CCCCn1c(=O)c2cc(OC)ccc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)cc(OC)c21 |
| InChI | InChI=1S/C22H21F6NO4/c1-4-5-8-29-18-15(14-7-6-13(32-2)11-16(14)19(29)30)9-12(10-17(18)33-3)20(31,21(23,24)25)22(26,27)28/h6-7,9-11,31H,4-5,8H2,1-3H3 |
| InChIKey | WSHHXIGETVKGRR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|