C23H25ClN4O3 — CID 52934165
1-[3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-(oxan-4-yl)urea (PubChem CID 52934165) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 52934165 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[3-chloro-4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-(oxan-4-yl)urea |
| SMILES | O=C(Nc1ccc(CCOc2ccccc2-c2cnc[nH]2)c(Cl)c1)NC1CCOCC1 |
| InChI | InChI=1S/C23H25ClN4O3/c24-20-13-18(28-23(29)27-17-8-10-30-11-9-17)6-5-16(20)7-12-31-22-4-2-1-3-19(22)21-14-25-15-26-21/h1-6,13-15,17H,7-12H2,(H,25,26)(H2,27,28,29) |
| InChIKey | BWIFFABIGNPDRG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |