C26H18BrFOS2 — CID 52948197
(E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-(5-phenylthiophen-2-yl)prop-2-en-1-one (PubChem CID 52948197) has the molecular formula C26H18BrFOS2 and a molecular weight of 509.47 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-(5-phenylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-(5-phenylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52948197 |
| Molecular Formula | C26H18BrFOS2 |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2-[(4-fluorophenyl)methylsulfanyl]-3-(5-phenylthiophen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(-c2ccccc2)s1)SCc1ccc(F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H18BrFOS2/c27-21-10-8-20(9-11-21)26(29)25(30-17-18-6-12-22(28)13-7-18)16-23-14-15-24(31-23)19-4-2-1-3-5-19/h1-16H,17H2/b25-16+ |
| InChIKey | CELOFOZLLVPTMJ-PCLIKHOPSA-N |
| XLogP | 8.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|