C16H20F3N3O4S — CID 52949230
1-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 52949230) has the molecular formula C16H20F3N3O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | 1-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 52949230 |
| Molecular Formula | C16H20F3N3O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | CC[C@H]1O[C@@H](NC(=S)N/N=C/c2ccc(C(F)(F)F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H20F3N3O4S/c1-2-10-11(23)12(24)13(25)14(26-10)21-15(27)22-20-7-8-3-5-9(6-4-8)16(17,18)19/h3-7,10-14,23-25H,2H2,1H3,(H2,21,22,27)/b20-7+/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | RAXUFWOPLRCUPY-GRZRYXLMSA-N |
| XLogP | 0.72 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|