C24H27N5O3 — CID 52989905
N-(furan-2-ylmethyl)-2-[[2-[methyl-(5-phenylpyrazolidin-3-yl)amino]acetyl]amino]benzamide (PubChem CID 52989905) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[2-[methyl-(5-phenylpyrazolidin-3-yl)amino]acetyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[2-[methyl-(5-phenylpyrazolidin-3-yl)amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 52989905 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[2-[methyl-(5-phenylpyrazolidin-3-yl)amino]acetyl]amino]benzamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(=O)NCc1ccco1)C1CC(c2ccccc2)NN1 |
| InChI | InChI=1S/C24H27N5O3/c1-29(22-14-21(27-28-22)17-8-3-2-4-9-17)16-23(30)26-20-12-6-5-11-19(20)24(31)25-15-18-10-7-13-32-18/h2-13,21-22,27-28H,14-16H2,1H3,(H,25,31)(H,26,30) |
| InChIKey | WMYXVIDTJJPSNS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |