C15H9F3N4O3 — CID 5304147
5-nitro-N-[3-(trifluoromethyl)phenyl]-1H-indazole-7-carboxamide (PubChem CID 5304147) has the molecular formula C15H9F3N4O3 and a molecular weight of 350.26 g/mol. Its IUPAC name is 5-nitro-N-[3-(trifluoromethyl)phenyl]-1H-indazole-7-carboxamide.
| Compound Name | 5-nitro-N-[3-(trifluoromethyl)phenyl]-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 5304147 |
| Molecular Formula | C15H9F3N4O3 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 5-nitro-N-[3-(trifluoromethyl)phenyl]-1H-indazole-7-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cc([N+](=O)[O-])cc2cn[nH]c12 |
| InChI | InChI=1S/C15H9F3N4O3/c16-15(17,18)9-2-1-3-10(5-9)20-14(23)12-6-11(22(24)25)4-8-7-19-21-13(8)12/h1-7H,(H,19,21)(H,20,23) |
| InChIKey | KAEURHVZLNJZIE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|