C18H20ClN5OS — CID 53067586
2-chloro-N-(3-propylsulfanylpropyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide (PubChem CID 53067586) has the molecular formula C18H20ClN5OS and a molecular weight of 389.91 g/mol. Its IUPAC name is 2-chloro-N-(3-propylsulfanylpropyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide.
| Compound Name | 2-chloro-N-(3-propylsulfanylpropyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 53067586 |
| Molecular Formula | C18H20ClN5OS |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-chloro-N-(3-propylsulfanylpropyl)-4-(triazolo[4,5-b]pyridin-3-yl)benzamide |
| SMILES | CCCSCCCNC(=O)c1ccc(-n2nnc3cccnc32)cc1Cl |
| InChI | InChI=1S/C18H20ClN5OS/c1-2-10-26-11-4-9-21-18(25)14-7-6-13(12-15(14)19)24-17-16(22-23-24)5-3-8-20-17/h3,5-8,12H,2,4,9-11H2,1H3,(H,21,25) |
| InChIKey | KRYUMAYXPCMFHA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|