C17H26N2O3 — CID 53095976
2-[2-(cycloheptylamino)-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid (PubChem CID 53095976) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[2-(cycloheptylamino)-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid.
| Compound Name | 2-[2-(cycloheptylamino)-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 53095976 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[2-(cycloheptylamino)-2-oxoethyl]-1-ethyl-4-methylpyrrole-3-carboxylic acid |
| SMILES | CCn1cc(C)c(C(=O)O)c1CC(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-19-11-12(2)16(17(21)22)14(19)10-15(20)18-13-8-6-4-5-7-9-13/h11,13H,3-10H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | YKIBCYXUYUHHAV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |