C16H19FN4O3S — CID 53115403
N-cyclopentyl-3-[(4-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 53115403) has the molecular formula C16H19FN4O3S and a molecular weight of 366.42 g/mol. Its IUPAC name is N-cyclopentyl-3-[(4-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-cyclopentyl-3-[(4-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53115403 |
| Molecular Formula | C16H19FN4O3S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-cyclopentyl-3-[(4-fluorophenyl)sulfamoyl]-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]nc(S(=O)(=O)Nc2ccc(F)cc2)c1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H19FN4O3S/c1-10-14(15(22)18-12-4-2-3-5-12)16(20-19-10)25(23,24)21-13-8-6-11(17)7-9-13/h6-9,12,21H,2-5H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | IIWBAPWDYDHJTJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |