C17H19N3O4S2 — CID 53130952
N-(3,4-dimethoxyphenyl)-4-(2-ethylpyrazol-3-yl)thiophene-2-sulfonamide (PubChem CID 53130952) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-(2-ethylpyrazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-(2-ethylpyrazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53130952 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-(2-ethylpyrazol-3-yl)thiophene-2-sulfonamide |
| SMILES | CCn1nccc1-c1csc(S(=O)(=O)Nc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-4-20-14(7-8-18-20)12-9-17(25-11-12)26(21,22)19-13-5-6-15(23-2)16(10-13)24-3/h5-11,19H,4H2,1-3H3 |
| InChIKey | JJHYBQLJJYKQNR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |