C19H22O3 — CID 5314146
1-methoxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione (PubChem CID 5314146) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-methoxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione.
| Compound Name | 1-methoxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione |
|---|---|
| PubChem CID | 5314146 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-methoxypentacyclo[10.2.2.25,8.02,11.04,9]octadeca-2(11),6-diene-3,10-dione |
| SMILES | COC12CCC(CC1)C1=C2C(=O)C2C3C=CC(CC3)C2C1=O |
| InChI | InChI=1S/C19H22O3/c1-22-19-8-6-12(7-9-19)15-16(19)18(21)14-11-4-2-10(3-5-11)13(14)17(15)20/h2,4,10-14H,3,5-9H2,1H3 |
| InChIKey | LZZKLFJNTPSFAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|