C15H12ClN5O2S — CID 53158252
N-(4-chlorophenyl)-N-(cyanomethyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide (PubChem CID 53158252) has the molecular formula C15H12ClN5O2S and a molecular weight of 361.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(cyanomethyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide.
| Compound Name | N-(4-chlorophenyl)-N-(cyanomethyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 53158252 |
| Molecular Formula | C15H12ClN5O2S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(4-chlorophenyl)-N-(cyanomethyl)-3-methyl-[1,2,4]triazolo[4,3-a]pyridine-6-sulfonamide |
| SMILES | Cc1nnc2ccc(S(=O)(=O)N(CC#N)c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C15H12ClN5O2S/c1-11-18-19-15-7-6-14(10-20(11)15)24(22,23)21(9-8-17)13-4-2-12(16)3-5-13/h2-7,10H,9H2,1H3 |
| InChIKey | UGHPFRUDDJBDJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|