C20H18FN5O2 — CID 53182486
4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)phthalazin-1-amine (PubChem CID 53182486) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)phthalazin-1-amine.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 53182486 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N-(3-methoxypropyl)phthalazin-1-amine |
| SMILES | COCCCNc1nnc(-c2nc(-c3ccc(F)cc3)no2)c2ccccc12 |
| InChI | InChI=1S/C20H18FN5O2/c1-27-12-4-11-22-19-16-6-3-2-5-15(16)17(24-25-19)20-23-18(26-28-20)13-7-9-14(21)10-8-13/h2-3,5-10H,4,11-12H2,1H3,(H,22,25) |
| InChIKey | AKPXPVDFNAYMFN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|