C23H25ClFN3O3 — CID 53197682
ethyl 2-(5-chloro-2-hydroxyphenyl)-4-(4-fluorophenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate (PubChem CID 53197682) has the molecular formula C23H25ClFN3O3 and a molecular weight of 445.92 g/mol. Its IUPAC name is ethyl 2-(5-chloro-2-hydroxyphenyl)-4-(4-fluorophenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate.
| Compound Name | ethyl 2-(5-chloro-2-hydroxyphenyl)-4-(4-fluorophenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 53197682 |
| Molecular Formula | C23H25ClFN3O3 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | ethyl 2-(5-chloro-2-hydroxyphenyl)-4-(4-fluorophenyl)-1,5,9-triazaspiro[5.5]undec-4-ene-9-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)N=C(c1ccc(F)cc1)CC(c1cc(Cl)ccc1O)N2 |
| InChI | InChI=1S/C23H25ClFN3O3/c1-2-31-22(30)28-11-9-23(10-12-28)26-19(15-3-6-17(25)7-4-15)14-20(27-23)18-13-16(24)5-8-21(18)29/h3-8,13,20,27,29H,2,9-12,14H2,1H3 |
| InChIKey | IARJTKLFUICYOX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|