C22H26N2O5 — CID 53208702
3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxy-1-methylindole-2-carboxylic acid (PubChem CID 53208702) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxy-1-methylindole-2-carboxylic acid.
| Compound Name | 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxy-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 53208702 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxy-1-methylindole-2-carboxylic acid |
| SMILES | COc1ccc2c(CNCCc3ccc(OC)c(OC)c3)c(C(=O)O)n(C)c2c1 |
| InChI | InChI=1S/C22H26N2O5/c1-24-18-12-15(27-2)6-7-16(18)17(21(24)22(25)26)13-23-10-9-14-5-8-19(28-3)20(11-14)29-4/h5-8,11-12,23H,9-10,13H2,1-4H3,(H,25,26) |
| InChIKey | ISHRJPBELJKDMU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|