C12H8F3NO2 — CID 53229611
2-[4-(trifluoromethoxy)phenyl]-1H-pyridin-4-one (PubChem CID 53229611) has the molecular formula C12H8F3NO2 and a molecular weight of 255.20 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-1H-pyridin-4-one.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 53229611 |
| Molecular Formula | C12H8F3NO2 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]c(-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C12H8F3NO2/c13-12(14,15)18-10-3-1-8(2-4-10)11-7-9(17)5-6-16-11/h1-7H,(H,16,17) |
| InChIKey | BLLBEBXNOCGOSJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |