C31H18F6O4 — CID 102183792
5,13-bis[4-(trifluoromethoxy)phenyl]tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione (PubChem CID 102183792) has the molecular formula C31H18F6O4 and a molecular weight of 568.47 g/mol. Its IUPAC name is 5,13-bis[4-(trifluoromethoxy)phenyl]tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione.
| Compound Name | 5,13-bis[4-(trifluoromethoxy)phenyl]tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione |
|---|---|
| PubChem CID | 102183792 |
| Molecular Formula | C31H18F6O4 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 5,13-bis[4-(trifluoromethoxy)phenyl]tetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-8,16-dione |
| SMILES | O=C1c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2C2CC1c1ccc(-c3ccc(OC(F)(F)F)cc3)cc1C2=O |
| InChI | InChI=1S/C31H18F6O4/c32-30(33,34)40-20-7-1-16(2-8-20)18-5-11-22-24(13-18)28(38)27-15-26(22)29(39)25-14-19(6-12-23(25)27)17-3-9-21(10-4-17)41-31(35,36)37/h1-14,26-27H,15H2 |
| InChIKey | WZIKFGZMAPCMHJ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |