C19H21NO5 — CID 53230671
methyl (1S,13S)-10-methoxy-17-oxo-12-oxa-4-azatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraene-4-carboxylate (PubChem CID 53230671) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl (1S,13S)-10-methoxy-17-oxo-12-oxa-4-azatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraene-4-carboxylate.
| Compound Name | methyl (1S,13S)-10-methoxy-17-oxo-12-oxa-4-azatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 53230671 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl (1S,13S)-10-methoxy-17-oxo-12-oxa-4-azatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraene-4-carboxylate |
| SMILES | COC(=O)N1CCc2ccc(OC)c3c2[C@]2(CC1)C(=O)C=CC[C@@H]2O3 |
| InChI | InChI=1S/C19H21NO5/c1-23-13-7-6-12-8-10-20(18(22)24-2)11-9-19-14(21)4-3-5-15(19)25-17(13)16(12)19/h3-4,6-7,15H,5,8-11H2,1-2H3/t15-,19+/m0/s1 |
| InChIKey | MJXROPCXYPZYNH-HNAYVOBHSA-N |
| XLogP | 2.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |