C21H38N8O6S3 — CID 53231456
(3S)-3-[[2-[[(2R)-6-(diaminomethylideneamino)-2-[[2-(1,2,5-dithiazepan-5-yl)acetyl]amino]hexanoyl]amino]acetyl]amino]-4-oxo-4-(2-sulfanylethylamino)butanoic acid (PubChem CID 53231456) has the molecular formula C21H38N8O6S3 and a molecular weight of 594.79 g/mol. Its IUPAC name is (3S)-3-[[2-[[(2R)-6-(diaminomethylideneamino)-2-[[2-(1,2,5-dithiazepan-5-yl)acetyl]amino]hexanoyl]amino]acetyl]amino]-4-oxo-4-(2-sulfanylethylamino)butanoic acid.
| Compound Name | (3S)-3-[[2-[[(2R)-6-(diaminomethylideneamino)-2-[[2-(1,2,5-dithiazepan-5-yl)acetyl]amino]hexanoyl]amino]acetyl]amino]-4-oxo-4-(2-sulfanylethylamino)butanoic acid |
|---|---|
| PubChem CID | 53231456 |
| Molecular Formula | C21H38N8O6S3 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | (3S)-3-[[2-[[(2R)-6-(diaminomethylideneamino)-2-[[2-(1,2,5-dithiazepan-5-yl)acetyl]amino]hexanoyl]amino]acetyl]amino]-4-oxo-4-(2-sulfanylethylamino)butanoic acid |
| SMILES | NC(N)=NCCCC[C@@H](NC(=O)CN1CCSSCC1)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)NCCS |
| InChI | InChI=1S/C21H38N8O6S3/c22-21(23)25-4-2-1-3-14(27-17(31)13-29-6-9-37-38-10-7-29)19(34)26-12-16(30)28-15(11-18(32)33)20(35)24-5-8-36/h14-15,36H,1-13H2,(H,24,35)(H,26,34)(H,27,31)(H,28,30)(H,32,33)(H4,22,23,25)/t14-,15+/m1/s1 |
| InChIKey | WHDOZJHYDCOMQI-CABCVRRESA-N |
| XLogP | -2.27 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|