C27H25F3INS — CID 53232152
1-(5-phenylpentyl)-3-[4-(trifluoromethyl)phenyl]sulfanylquinolin-1-ium iodide (PubChem CID 53232152) has the molecular formula C27H25F3INS and a molecular weight of 579.47 g/mol. Its IUPAC name is 1-(5-phenylpentyl)-3-[4-(trifluoromethyl)phenyl]sulfanylquinolin-1-ium iodide.
| Compound Name | 1-(5-phenylpentyl)-3-[4-(trifluoromethyl)phenyl]sulfanylquinolin-1-ium iodide |
|---|---|
| PubChem CID | 53232152 |
| Molecular Formula | C27H25F3INS |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | 1-(5-phenylpentyl)-3-[4-(trifluoromethyl)phenyl]sulfanylquinolin-1-ium iodide |
| SMILES | FC(F)(F)c1ccc(Sc2cc3ccccc3[n+](CCCCCc3ccccc3)c2)cc1.[I-] |
| InChI | InChI=1S/C27H25F3NS.HI/c28-27(29,30)23-14-16-24(17-15-23)32-25-19-22-12-6-7-13-26(22)31(20-25)18-8-2-5-11-21-9-3-1-4-10-21;/h1,3-4,6-7,9-10,12-17,19-20H,2,5,8,11,18H2;1H/q+1;/p-1 |
| InChIKey | FSFSSNSMAYBFTM-UHFFFAOYSA-M |
| XLogP | 4.71 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|