C26H38NO2+ — CID 53232683
(3S,7S,8R,9S,10S,13S,14S)-13-ethyl-10,16-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 53232683) has the molecular formula C26H38NO2+ and a molecular weight of 396.60 g/mol. Its IUPAC name is (3S,7S,8R,9S,10S,13S,14S)-13-ethyl-10,16-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3S,7S,8R,9S,10S,13S,14S)-13-ethyl-10,16-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 53232683 |
| Molecular Formula | C26H38NO2+ |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | (3S,7S,8R,9S,10S,13S,14S)-13-ethyl-10,16-dimethyl-17-pyridin-1-ium-1-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | CC[C@]12CC[C@H]3[C@@H]([C@@H](O)CC4C[C@@H](O)CC[C@@]43C)[C@@H]1CC(C)=C2[n+]1ccccc1 |
| InChI | InChI=1S/C26H38NO2/c1-4-26-11-9-20-23(22(29)16-18-15-19(28)8-10-25(18,20)3)21(26)14-17(2)24(26)27-12-6-5-7-13-27/h5-7,12-13,18-23,28-29H,4,8-11,14-16H2,1-3H3/q+1/t18?,19-,20-,21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | VLJNTXCPRAWIJP-QVTMXMHLSA-N |
| XLogP | 4.58 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|