C14H22O3 — CID 53235927
(2R,3R,4aR,8aR)-3-prop-2-enoxy-2-prop-2-enyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 53235927) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R,3R,4aR,8aR)-3-prop-2-enoxy-2-prop-2-enyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2R,3R,4aR,8aR)-3-prop-2-enoxy-2-prop-2-enyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 53235927 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2R,3R,4aR,8aR)-3-prop-2-enoxy-2-prop-2-enyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | C=CCO[C@@H]1C[C@H]2OCCC[C@H]2O[C@@H]1CC=C |
| InChI | InChI=1S/C14H22O3/c1-3-6-11-13(15-8-4-2)10-14-12(17-11)7-5-9-16-14/h3-4,11-14H,1-2,5-10H2/t11-,12-,13-,14-/m1/s1 |
| InChIKey | PZFVGRAGRQUVRJ-AAVRWANBSA-N |
| XLogP | 2.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|