C11H18N2O4S2 — CID 53240150
(5aR,8S)-8-[(2S)-butan-2-yl]-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione (PubChem CID 53240150) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (5aR,8S)-8-[(2S)-butan-2-yl]-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione.
| Compound Name | (5aR,8S)-8-[(2S)-butan-2-yl]-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
|---|---|
| PubChem CID | 53240150 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (5aR,8S)-8-[(2S)-butan-2-yl]-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@@H]2CSCCS(=O)(=O)N2C1=O |
| InChI | InChI=1S/C11H18N2O4S2/c1-3-7(2)9-11(15)13-8(10(14)12-9)6-18-4-5-19(13,16)17/h7-9H,3-6H2,1-2H3,(H,12,14)/t7-,8-,9-/m0/s1 |
| InChIKey | RLIBNXISHRXSCA-CIUDSAMLSA-N |
| XLogP | -0.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |