C20H25NO6S2 — CID 53241059
[(2-methylsulfonylphenyl)sulfonylamino] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 53241059) has the molecular formula C20H25NO6S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is [(2-methylsulfonylphenyl)sulfonylamino] 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [(2-methylsulfonylphenyl)sulfonylamino] 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 53241059 |
| Molecular Formula | C20H25NO6S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | [(2-methylsulfonylphenyl)sulfonylamino] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)ONS(=O)(=O)c2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25NO6S2/c1-14(2)13-16-9-11-17(12-10-16)15(3)20(22)27-21-29(25,26)19-8-6-5-7-18(19)28(4,23)24/h5-12,14-15,21H,13H2,1-4H3 |
| InChIKey | NKFHYTHTIOQHAT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|