C12H17NO6S2 — CID 53241260
[(3-methylsulfonylphenyl)sulfonylamino] 2,2-dimethylpropanoate (PubChem CID 53241260) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3-methylsulfonylphenyl)sulfonylamino] 2,2-dimethylpropanoate.
| Compound Name | [(3-methylsulfonylphenyl)sulfonylamino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53241260 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | [(3-methylsulfonylphenyl)sulfonylamino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONS(=O)(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H17NO6S2/c1-12(2,3)11(14)19-13-21(17,18)10-7-5-6-9(8-10)20(4,15)16/h5-8,13H,1-4H3 |
| InChIKey | SOFMVEDKUGWRLI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|