C18H19Cl3N2O8 — CID 53242816
[1-(1-ethoxycarbonylcyclopropyl)-2-(2,2,2-trichloroethoxycarbonylamino)ethyl] 4-nitrobenzoate (PubChem CID 53242816) has the molecular formula C18H19Cl3N2O8 and a molecular weight of 497.72 g/mol. Its IUPAC name is [1-(1-ethoxycarbonylcyclopropyl)-2-(2,2,2-trichloroethoxycarbonylamino)ethyl] 4-nitrobenzoate.
| Compound Name | [1-(1-ethoxycarbonylcyclopropyl)-2-(2,2,2-trichloroethoxycarbonylamino)ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 53242816 |
| Molecular Formula | C18H19Cl3N2O8 |
| Molecular Weight | 497.72 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | [1-(1-ethoxycarbonylcyclopropyl)-2-(2,2,2-trichloroethoxycarbonylamino)ethyl] 4-nitrobenzoate |
| SMILES | CCOC(=O)C1(C(CNC(=O)OCC(Cl)(Cl)Cl)OC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H19Cl3N2O8/c1-2-29-15(25)17(7-8-17)13(9-22-16(26)30-10-18(19,20)21)31-14(24)11-3-5-12(6-4-11)23(27)28/h3-6,13H,2,7-10H2,1H3,(H,22,26) |
| InChIKey | OBDQFKQTXPNQOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|