C25H30O12 — CID 53260923
[1-(4-methoxy-7-oxofuro[3,2-g]chromen-6-yl)-3-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutan-2-yl] acetate (PubChem CID 53260923) has the molecular formula C25H30O12 and a molecular weight of 522.50 g/mol. Its IUPAC name is [1-(4-methoxy-7-oxofuro[3,2-g]chromen-6-yl)-3-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutan-2-yl] acetate.
| Compound Name | [1-(4-methoxy-7-oxofuro[3,2-g]chromen-6-yl)-3-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 53260923 |
| Molecular Formula | C25H30O12 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [1-(4-methoxy-7-oxofuro[3,2-g]chromen-6-yl)-3-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutan-2-yl] acetate |
| SMILES | COc1c2ccoc2cc2oc(=O)c(CC(OC(C)=O)C(C)(C)O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc12 |
| InChI | InChI=1S/C25H30O12/c1-11(27)34-18(25(2,3)37-24-21(30)20(29)19(28)17(10-26)36-24)8-12-7-14-16(35-23(12)31)9-15-13(5-6-33-15)22(14)32-4/h5-7,9,17-21,24,26,28-30H,8,10H2,1-4H3/t17-,18?,19-,20+,21-,24+/m1/s1 |
| InChIKey | LPOGNBISSOHXID-VXCUJOGUSA-N |
| XLogP | 0.62 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|