C12H13ClN2O5S — CID 53270575
2-(5-chloro-2-hydroxy-4-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53270575) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is 2-(5-chloro-2-hydroxy-4-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(5-chloro-2-hydroxy-4-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53270575 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(5-chloro-2-hydroxy-4-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)SC(c2cc(Cl)c([N+](=O)[O-])cc2O)NC1C(=O)O |
| InChI | InChI=1S/C12H13ClN2O5S/c1-12(2)9(11(17)18)14-10(21-12)5-3-6(13)7(15(19)20)4-8(5)16/h3-4,9-10,14,16H,1-2H3,(H,17,18) |
| InChIKey | RNUVWVXLEUDWMY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|