C14H18N2O7S — CID 53270621
2-(2-hydroxy-3,6-dimethoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53270621) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-(2-hydroxy-3,6-dimethoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(2-hydroxy-3,6-dimethoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53270621 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-(2-hydroxy-3,6-dimethoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1cc([N+](=O)[O-])c(OC)c(C2NC(C(=O)O)C(C)(C)S2)c1O |
| InChI | InChI=1S/C14H18N2O7S/c1-14(2)11(13(18)19)15-12(24-14)8-9(17)7(22-3)5-6(16(20)21)10(8)23-4/h5,11-12,15,17H,1-4H3,(H,18,19) |
| InChIKey | BIDDANMDIPHIRR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|