C13H16N2O6S — CID 53270593
2-(2-hydroxy-3-methoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53270593) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-(2-hydroxy-3-methoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(2-hydroxy-3-methoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53270593 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-(2-hydroxy-3-methoxy-5-nitrophenyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1cc([N+](=O)[O-])cc(C2NC(C(=O)O)C(C)(C)S2)c1O |
| InChI | InChI=1S/C13H16N2O6S/c1-13(2)10(12(17)18)14-11(22-13)7-4-6(15(19)20)5-8(21-3)9(7)16/h4-5,10-11,14,16H,1-3H3,(H,17,18) |
| InChIKey | ZLUBVFJCYFVRGW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|