C13H14Cl2N3O3+ — CID 53274838
N-[3-[(2,4-dichlorophenyl)methyl]-4-(1-hydroxyethyl)oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53274838) has the molecular formula C13H14Cl2N3O3+ and a molecular weight of 331.18 g/mol. Its IUPAC name is N-[3-[(2,4-dichlorophenyl)methyl]-4-(1-hydroxyethyl)oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | N-[3-[(2,4-dichlorophenyl)methyl]-4-(1-hydroxyethyl)oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53274838 |
| Molecular Formula | C13H14Cl2N3O3+ |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[3-[(2,4-dichlorophenyl)methyl]-4-(1-hydroxyethyl)oxadiazol-3-ium-5-yl]acetamide |
| SMILES | CC(=O)Nc1on[n+](Cc2ccc(Cl)cc2Cl)c1C(C)O |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-7(19)12-13(16-8(2)20)21-17-18(12)6-9-3-4-10(14)5-11(9)15/h3-5,7,19H,6H2,1-2H3/p+1 |
| InChIKey | NMDDYKUWYUZHDL-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|