C11H9Cl3N3O2+ — CID 53275505
2-chloro-N-[3-[(2,4-dichlorophenyl)methyl]oxadiazol-3-ium-5-yl]acetamide (PubChem CID 53275505) has the molecular formula C11H9Cl3N3O2+ and a molecular weight of 321.57 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2,4-dichlorophenyl)methyl]oxadiazol-3-ium-5-yl]acetamide.
| Compound Name | 2-chloro-N-[3-[(2,4-dichlorophenyl)methyl]oxadiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 53275505 |
| Molecular Formula | C11H9Cl3N3O2+ |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 2-chloro-N-[3-[(2,4-dichlorophenyl)methyl]oxadiazol-3-ium-5-yl]acetamide |
| SMILES | O=C(CCl)Nc1c[n+](Cc2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C11H8Cl3N3O2/c12-4-10(18)15-11-6-17(16-19-11)5-7-1-2-8(13)3-9(7)14/h1-3,6H,4-5H2/p+1 |
| InChIKey | GOAJZPSRSWEGFL-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 59.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|