C12H11Cl2NO3S — CID 53276026
6-[(2,4-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 53276026) has the molecular formula C12H11Cl2NO3S and a molecular weight of 320.20 g/mol. Its IUPAC name is 6-[(2,4-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | 6-[(2,4-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 53276026 |
| Molecular Formula | C12H11Cl2NO3S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 6-[(2,4-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSC(Cc2ccc(Cl)cc2Cl)C(=O)N1 |
| InChI | InChI=1S/C12H11Cl2NO3S/c13-7-2-1-6(8(14)4-7)3-10-11(16)15-9(5-19-10)12(17)18/h1-2,4,9-10H,3,5H2,(H,15,16)(H,17,18) |
| InChIKey | QGKFMAHNKFCGEZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |