C16H11F2N3O3S — CID 53291445
4-[2-(3,4-difluoroanilino)-2-oxoethyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate (PubChem CID 53291445) has the molecular formula C16H11F2N3O3S and a molecular weight of 363.35 g/mol. Its IUPAC name is 4-[2-(3,4-difluoroanilino)-2-oxoethyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-(3,4-difluoroanilino)-2-oxoethyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53291445 |
| Molecular Formula | C16H11F2N3O3S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 4-[2-(3,4-difluoroanilino)-2-oxoethyl]sulfanyl-3-phenyloxadiazol-3-ium-5-olate |
| SMILES | O=C(CSc1c([O-])on[n+]1-c1ccccc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H11F2N3O3S/c17-12-7-6-10(8-13(12)18)19-14(22)9-25-15-16(23)24-20-21(15)11-4-2-1-3-5-11/h1-8H,9H2,(H-,19,20,22,23) |
| InChIKey | KFKBYZKHYJRHOP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|