C17H21N3O5S — CID 53292045
4-[1-(4-butoxycarbonylanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate (PubChem CID 53292045) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-[1-(4-butoxycarbonylanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate.
| Compound Name | 4-[1-(4-butoxycarbonylanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 53292045 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-[1-(4-butoxycarbonylanilino)-1-oxopropan-2-yl]sulfanyl-3-methyloxadiazol-3-ium-5-olate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2c([O-])on[n+]2C)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-4-5-10-24-16(22)12-6-8-13(9-7-12)18-14(21)11(2)26-15-17(23)25-19-20(15)3/h6-9,11H,4-5,10H2,1-3H3,(H-,18,19,21,22,23) |
| InChIKey | FAQWCDHYZQPOFF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|