C19H20N3O3S+ — CID 53293828
N-(2,5-dimethylphenyl)-3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide (PubChem CID 53293828) has the molecular formula C19H20N3O3S+ and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 53293828 |
| Molecular Formula | C19H20N3O3S+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCSc2c(=O)o[nH][n+]2-c2ccccc2)c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-13-8-9-14(2)16(12-13)20-17(23)10-11-26-18-19(24)25-21-22(18)15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3,(H-,20,21,23,24)/p+1 |
| InChIKey | KOJCLVVZTKKXOP-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|