C10H14N2O2S2 — CID 53303035
imidazole-1-carbothioylsulfanylmethyl 2,2-dimethylpropanoate (PubChem CID 53303035) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is imidazole-1-carbothioylsulfanylmethyl 2,2-dimethylpropanoate.
| Compound Name | imidazole-1-carbothioylsulfanylmethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 53303035 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | imidazole-1-carbothioylsulfanylmethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCSC(=S)n1ccnc1 |
| InChI | InChI=1S/C10H14N2O2S2/c1-10(2,3)8(13)14-7-16-9(15)12-5-4-11-6-12/h4-6H,7H2,1-3H3 |
| InChIKey | WXLDQLZSHPGNSG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|