C14H22N2O — CID 54469700
4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-one (PubChem CID 54469700) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-one.
| Compound Name | 4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-one |
|---|---|
| PubChem CID | 54469700 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-one |
| SMILES | CC(C)(C)C=C(C(=O)C(C)(C)C)n1ccnc1 |
| InChI | InChI=1S/C14H22N2O/c1-13(2,3)9-11(12(17)14(4,5)6)16-8-7-15-10-16/h7-10H,1-6H3 |
| InChIKey | XHKZEPBNICWETP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|