C14H18KN3O3S3 — CID 53304484
potassium N-[[2-[2-(2-carboxyethylamino)-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate (PubChem CID 53304484) has the molecular formula C14H18KN3O3S3 and a molecular weight of 411.62 g/mol. Its IUPAC name is potassium N-[[2-[2-(2-carboxyethylamino)-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate.
| Compound Name | potassium N-[[2-[2-(2-carboxyethylamino)-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate |
|---|---|
| PubChem CID | 53304484 |
| Molecular Formula | C14H18KN3O3S3 |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | potassium N-[[2-[2-(2-carboxyethylamino)-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate |
| SMILES | O=C(O)CCNc1sc2c(c1CC(=O)NNC(=S)[S-])CCCC2.[K+] |
| InChI | InChI=1S/C14H19N3O3S3.K/c18-11(16-17-14(21)22)7-9-8-3-1-2-4-10(8)23-13(9)15-6-5-12(19)20;/h15H,1-7H2,(H,16,18)(H,19,20)(H2,17,21,22);/q;+1/p-1 |
| InChIKey | IQDAXGFTYRHFGG-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|