C13H15ClKN3O2S3 — CID 53304329
potassium N-[[2-[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate (PubChem CID 53304329) has the molecular formula C13H15ClKN3O2S3 and a molecular weight of 416.03 g/mol. Its IUPAC name is potassium N-[[2-[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate.
| Compound Name | potassium N-[[2-[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate |
|---|---|
| PubChem CID | 53304329 |
| Molecular Formula | C13H15ClKN3O2S3 |
| Molecular Weight | 416.03 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | potassium N-[[2-[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]acetyl]amino]carbamodithioate |
| SMILES | O=C(Cc1c(NC(=O)CCl)sc2c1CCCC2)NNC(=S)[S-].[K+] |
| InChI | InChI=1S/C13H16ClN3O2S3.K/c14-6-11(19)15-12-8(5-10(18)16-17-13(20)21)7-3-1-2-4-9(7)22-12;/h1-6H2,(H,15,19)(H,16,18)(H2,17,20,21);/q;+1/p-1 |
| InChIKey | RYDVJCNQBYOHHU-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.03 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|