C29H28ClN7O4S2 — CID 53304650
N-[3-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-5-[[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methyl]-1,2,4-triazol-4-yl]benzamide (PubChem CID 53304650) has the molecular formula C29H28ClN7O4S2 and a molecular weight of 638.18 g/mol. Its IUPAC name is N-[3-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-5-[[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methyl]-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-5-[[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methyl]-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 53304650 |
| Molecular Formula | C29H28ClN7O4S2 |
| Molecular Weight | 638.18 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | N-[3-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-5-[[2-[(2-chloroacetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methyl]-1,2,4-triazol-4-yl]benzamide |
| SMILES | O=C(CSc1nnc(Cc2c(NC(=O)CCl)sc3c2CCCC3)n1NC(=O)c1ccccc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28ClN7O4S2/c30-16-24(38)31-28-21(20-13-7-8-14-22(20)43-28)15-23-32-35-29(37(23)36-27(41)19-11-5-2-6-12-19)42-17-25(39)33-34-26(40)18-9-3-1-4-10-18/h1-6,9-12H,7-8,13-17H2,(H,31,38)(H,33,39)(H,34,40)(H,36,41) |
| InChIKey | FEGLECKDGAKPIQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 147.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|