C23H25N9O2S3 — CID 53305399
N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-4-yl]benzamide (PubChem CID 53305399) has the molecular formula C23H25N9O2S3 and a molecular weight of 555.72 g/mol. Its IUPAC name is N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 53305399 |
| Molecular Formula | C23H25N9O2S3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-4-yl]benzamide |
| SMILES | CC(=O)Nc1sc2c(c1Cc1nnc(SCc3n[nH]c(=S)n3N)n1NC(=O)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C23H25N9O2S3/c1-13(33)25-21-16(15-9-5-6-10-17(15)37-21)11-18-26-29-23(36-12-19-27-28-22(35)31(19)24)32(18)30-20(34)14-7-3-2-4-8-14/h2-4,7-8H,5-6,9-12,24H2,1H3,(H,25,33)(H,28,35)(H,30,34) |
| InChIKey | HIDCUOMINCUVMR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|