C24H27N9O3S3 — CID 53305553
3-[[3-[[5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-4-benzamido-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]propanoic acid (PubChem CID 53305553) has the molecular formula C24H27N9O3S3 and a molecular weight of 585.74 g/mol. Its IUPAC name is 3-[[3-[[5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-4-benzamido-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]propanoic acid.
| Compound Name | 3-[[3-[[5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-4-benzamido-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 53305553 |
| Molecular Formula | C24H27N9O3S3 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 3-[[3-[[5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-4-benzamido-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]propanoic acid |
| SMILES | Nn1c(CSc2nnc(Cc3c(NCCC(=O)O)sc4c3CCCC4)n2NC(=O)c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C24H27N9O3S3/c25-32-19(28-29-23(32)37)13-38-24-30-27-18(33(24)31-21(36)14-6-2-1-3-7-14)12-16-15-8-4-5-9-17(15)39-22(16)26-11-10-20(34)35/h1-3,6-7,26H,4-5,8-13,25H2,(H,29,37)(H,31,36)(H,34,35) |
| InChIKey | DUETXKNXFRANMW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|