C18H23N9O2S3 — CID 53305555
N-[3-[[4-acetamido-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide (PubChem CID 53305555) has the molecular formula C18H23N9O2S3 and a molecular weight of 493.64 g/mol. Its IUPAC name is N-[3-[[4-acetamido-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide.
| Compound Name | N-[3-[[4-acetamido-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 53305555 |
| Molecular Formula | C18H23N9O2S3 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-[3-[[4-acetamido-5-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]acetamide |
| SMILES | CC(=O)Nc1sc2c(c1Cc1nnc(SCc3n[nH]c(=S)n3N)n1NC(C)=O)CCCC2 |
| InChI | InChI=1S/C18H23N9O2S3/c1-9(28)20-16-12(11-5-3-4-6-13(11)32-16)7-14-21-24-18(27(14)25-10(2)29)31-8-15-22-23-17(30)26(15)19/h3-8,19H2,1-2H3,(H,20,28)(H,23,30)(H,25,29) |
| InChIKey | KKLFTODOKWVOJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|