C27H24N6O2S2 — CID 53305551
N-[3-[[4-benzamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide (PubChem CID 53305551) has the molecular formula C27H24N6O2S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[3-[[4-benzamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide.
| Compound Name | N-[3-[[4-benzamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 53305551 |
| Molecular Formula | C27H24N6O2S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | N-[3-[[4-benzamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]benzamide |
| SMILES | N#CCSc1nnc(Cc2c(NC(=O)c3ccccc3)sc3c2CCCC3)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24N6O2S2/c28-15-16-36-27-31-30-23(33(27)32-25(35)19-11-5-2-6-12-19)17-21-20-13-7-8-14-22(20)37-26(21)29-24(34)18-9-3-1-4-10-18/h1-6,9-12H,7-8,13-14,16-17H2,(H,29,34)(H,32,35) |
| InChIKey | QHGYHFWTKKIXPB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |