C22H22N6O2S2 — CID 53305550
N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-(cyanomethylsulfanyl)-1,2,4-triazol-4-yl]benzamide (PubChem CID 53305550) has the molecular formula C22H22N6O2S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-(cyanomethylsulfanyl)-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-(cyanomethylsulfanyl)-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 53305550 |
| Molecular Formula | C22H22N6O2S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[3-[(2-acetamido-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)methyl]-5-(cyanomethylsulfanyl)-1,2,4-triazol-4-yl]benzamide |
| SMILES | CC(=O)Nc1sc2c(c1Cc1nnc(SCC#N)n1NC(=O)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C22H22N6O2S2/c1-14(29)24-21-17(16-9-5-6-10-18(16)32-21)13-19-25-26-22(31-12-11-23)28(19)27-20(30)15-7-3-2-4-8-15/h2-4,7-8H,5-6,9-10,12-13H2,1H3,(H,24,29)(H,27,30) |
| InChIKey | KHPWKCOFVQNLDH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |