C17H19ClN6O2S2 — CID 53305716
N-[3-[[4-acetamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-chloroacetamide (PubChem CID 53305716) has the molecular formula C17H19ClN6O2S2 and a molecular weight of 438.97 g/mol. Its IUPAC name is N-[3-[[4-acetamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-chloroacetamide.
| Compound Name | N-[3-[[4-acetamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 53305716 |
| Molecular Formula | C17H19ClN6O2S2 |
| Molecular Weight | 438.97 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[3-[[4-acetamido-5-(cyanomethylsulfanyl)-1,2,4-triazol-3-yl]methyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-chloroacetamide |
| SMILES | CC(=O)Nn1c(Cc2c(NC(=O)CCl)sc3c2CCCC3)nnc1SCC#N |
| InChI | InChI=1S/C17H19ClN6O2S2/c1-10(25)23-24-14(21-22-17(24)27-7-6-19)8-12-11-4-2-3-5-13(11)28-16(12)20-15(26)9-18/h2-5,7-9H2,1H3,(H,20,26)(H,23,25) |
| InChIKey | YOOLJWCJXSFKSE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|