C19H18Cl2N8O4S2 — CID 16729286
N-[3-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-5-[2-[2-(2-chloroacetyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide (PubChem CID 16729286) has the molecular formula C19H18Cl2N8O4S2 and a molecular weight of 557.45 g/mol. Its IUPAC name is N-[3-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-5-[2-[2-(2-chloroacetyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-5-[2-[2-(2-chloroacetyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 16729286 |
| Molecular Formula | C19H18Cl2N8O4S2 |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | N-[3-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-5-[2-[2-(2-chloroacetyl)hydrazinyl]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]benzamide |
| SMILES | O=C(CCl)NNC(=O)CSc1nnc(Cc2csc(NC(=O)CCl)n2)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18Cl2N8O4S2/c20-7-14(30)23-18-22-12(9-34-18)6-13-24-27-19(35-10-16(32)26-25-15(31)8-21)29(13)28-17(33)11-4-2-1-3-5-11/h1-5,9H,6-8,10H2,(H,25,31)(H,26,32)(H,28,33)(H,22,23,30) |
| InChIKey | WKMWVRQSEXHGRD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|