C18H17ClN10O2S3 — CID 16729294
N-[3-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-5-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-1,2,4-triazol-4-yl]benzamide (PubChem CID 16729294) has the molecular formula C18H17ClN10O2S3 and a molecular weight of 537.06 g/mol. Its IUPAC name is N-[3-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-5-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[3-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-5-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 16729294 |
| Molecular Formula | C18H17ClN10O2S3 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | N-[3-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methylsulfanyl]-5-[[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]methyl]-1,2,4-triazol-4-yl]benzamide |
| SMILES | Nn1c(CSc2nnc(Cc3csc(NC(=O)CCl)n3)n2NC(=O)c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C18H17ClN10O2S3/c19-7-14(30)22-16-21-11(8-33-16)6-12-23-26-18(34-9-13-24-25-17(32)28(13)20)29(12)27-15(31)10-4-2-1-3-5-10/h1-5,8H,6-7,9,20H2,(H,25,32)(H,27,31)(H,21,22,30) |
| InChIKey | PDJLIOMKTCTSIZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 161.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|