C15H16O6 — CID 53305566
[(2R,6R)-2-(4-methoxyphenoxy)-5-oxo-2H-pyran-6-yl]methyl acetate (PubChem CID 53305566) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is [(2R,6R)-2-(4-methoxyphenoxy)-5-oxo-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(2R,6R)-2-(4-methoxyphenoxy)-5-oxo-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 53305566 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [(2R,6R)-2-(4-methoxyphenoxy)-5-oxo-2H-pyran-6-yl]methyl acetate |
| SMILES | COc1ccc(O[C@@H]2C=CC(=O)[C@@H](COC(C)=O)O2)cc1 |
| InChI | InChI=1S/C15H16O6/c1-10(16)19-9-14-13(17)7-8-15(21-14)20-12-5-3-11(18-2)4-6-12/h3-8,14-15H,9H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | LLAVTKFZTVKHTG-CABCVRRESA-N |
| XLogP | 1.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |